| Melting point |
172-175 °C(lit.) |
| Boiling point |
545.7±60.0 °C(Predicted) |
| Density |
1.614±0.06 g/cm3(Predicted) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
DMSO (Slightly), Isopropanol (Slightly), Methanol |
| form |
powder to crystal |
| pka |
1.04±0.50(Predicted) |
| color |
White to Almost white |
| Water Solubility |
almost transparency |
| InChI |
InChI=1S/C12H9N2O8P/c15-13(16)9-1-5-11(6-2-9)21-23(19,20)22-12-7-3-10(4-8-12)14(17)18/h1-8H,(H,19,20) |
| InChIKey |
MHSVUSZEHNVFKW-UHFFFAOYSA-N |
| SMILES |
P(O)(OC1=CC=C([N+]([O-])=O)C=C1)(OC1=CC=C([N+]([O-])=O)C=C1)=O |
| CAS DataBase Reference |
645-15-8(CAS DataBase Reference) |
| NIST Chemistry Reference |
Phosphoric acid, bis(p-nitrophenyl) ester(645-15-8) |
| EPA Substance Registry System |
Bis(p-nitrophenyl) phosphate (645-15-8) |
