4-Amino-3,5-dichlorobenzotrifluoride
- Product Name4-Amino-3,5-dichlorobenzotrifluoride
- CAS24279-39-8
- MFC7H4Cl2F3N
- MW230.01
- EINECS416-430-0
- MOL File24279-39-8.mol
Chemical Properties
| Melting point | 34-36 °C(lit.) |
| Boiling point | 60-62 °C1 mm Hg(lit.) |
| Density | 1.532 g/mL at 25 °C(lit.) |
| Flash point | 190 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to lump |
| pka | -1.13±0.10(Predicted) |
| Specific Gravity | 1.532 |
| color | White to Orange to Green |
| BRN | 2838819 |
| InChI | InChI=1S/C7H4Cl2F3N/c8-4-1-3(7(10,11)12)2-5(9)6(4)13/h1-2H,13H2 |
| InChIKey | ITNMAZSPBLRJLU-UHFFFAOYSA-N |
| SMILES | C1(N)=C(Cl)C=C(C(F)(F)F)C=C1Cl |
| CAS DataBase Reference | 24279-39-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,N,T |
| Risk Statements | 20/22-38-43-50/53 |
| Safety Statements | 24-37-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29214300 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
