2,4,6-Trifluorobenzoic acid
- Product Name2,4,6-Trifluorobenzoic acid
- CAS28314-80-9
- MFC7H3F3O2
- MW176.09
- EINECS220-603-4
- MOL File28314-80-9.mol
Chemical Properties
| Melting point | 142-145 °C (lit.) |
| Boiling point | 218.2±35.0 °C(Predicted) |
| Density | 1.4362 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.28±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 1958300 |
| InChI | InChI=1S/C7H3F3O2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H,(H,11,12) |
| InChIKey | SJZATRRXUILGHH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(F)C=C(F)C=C1F |
| CAS DataBase Reference | 28314-80-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
