Triphenylformazan
- Product NameTriphenylformazan
- CAS531-52-2
- MFC19H16N4
- MW300.36
- EINECS208-509-1
- MOL File531-52-2.mol
Chemical Properties
| Melting point | 169-170 °C |
| Boiling point | 431.59°C (rough estimate) |
| Density | 1.1454 (rough estimate) |
| refractive index | 1.6140 (estimate) |
| storage temp. | Store at 2-8 |
| solubility | dioxane: 50 mg/mL, clear |
| pka | 11.56±0.10(Predicted) |
| form | powder to crystaline |
| color | Orange to Brown to Dark red |
| BRN | 753057 |
| InChI | 1S/C19H16N4/c1-4-10-16(11-5-1)19(22-20-17-12-6-2-7-13-17)23-21-18-14-8-3-9-15-18/h1-15,20H/b22-19-,23-21+ |
| InChIKey | BEIHVSJTPTXQGB-YMGPPEANSA-N |
| SMILES | N(\N=C(/N=N/c1ccccc1)c2ccccc2)c3ccccc3 |
| CAS DataBase Reference | 531-52-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Triphenylformazan(531-52-2) |
| EPA Substance Registry System | Diazene, phenyl[phenyl(phenylhydrazono)methyl]- (531-52-2) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 60-61-24/25-22 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| F | 8-10-23 |
| TSCA | TSCA listed |
| HS Code | 3212900000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 |
