Malonic dihydrazide
- Product NameMalonic dihydrazide
- CAS3815-86-9
- MFC3H8N4O2
- MW132.12
- EINECS670-404-5
- MOL File3815-86-9.mol
Chemical Properties
| Melting point | 152-154°C |
| Boiling point | 554.0±33.0 °C(Predicted) |
| Density | 1.358±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| form | powder to crystal |
| pka | 11.88±0.35(Predicted) |
| color | White to Almost white |
| BRN | 1072337 |
| InChI | InChI=1S/C3H8N4O2/c4-6-2(8)1-3(9)7-5/h1,4-5H2,(H,6,8)(H,7,9) |
| InChIKey | PSIKPHJLTVSQFO-UHFFFAOYSA-N |
| SMILES | C(C(=O)NN)C(=O)NN |
| CAS DataBase Reference | 3815-86-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Propanedioyl dihydrazide(3815-86-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RTECS | OO8000000 |
| HS Code | 2928.00.5000 |
| HazardClass | IRRITANT |
