| Melting point |
32-34 °C(lit.) |
| Boiling point |
106-107 °C4 mm Hg(lit.) |
| Density |
1.12 |
| refractive index |
1.5392 (estimate) |
| Flash point |
>230 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
powder to lump to clear liquid |
| pka |
12.33±0.20(Predicted) |
| color |
White or Colorless to Light yellow |
| optical activity |
[α]21/D +134°, c = 3 in chloroform |
| FreezingPoint |
27.0 to 30.0 ℃ |
| InChI |
1S/C10H12O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3/t9-/m0/s1 |
| InChIKey |
SAXHIDRUJXPDOD-VIFPVBQESA-N |
| SMILES |
CCOC(=O)[C@@H](O)c1ccccc1 |
| CAS DataBase Reference |
13704-09-1(CAS DataBase Reference) |
