
4-acetyl-2-methylbenzoic acid
- Product Name4-acetyl-2-methylbenzoic acid
- CAS55860-35-0
- MFC10H10O3
- MW178.18
- EINECS856-079-4
- MOL File55860-35-0.mol
Chemical Properties
Boiling point | 352.7±30.0 °C(Predicted) |
Density | 1.189±0.06 g/cm3(Predicted) |
vapor pressure | 0Pa at 20℃ |
pka | 3.25±0.25(Predicted) |
InChI | InChI=1S/C10H10O3/c1-6-5-8(7(2)11)3-4-9(6)10(12)13/h3-5H,1-2H3,(H,12,13) |
InChIKey | QGXDUDDPMXVLOO-UHFFFAOYSA-N |
SMILES | C(O)(=O)C1=CC=C(C(C)=O)C=C1C |
LogP | -2.5-0.14 at 20℃ and pH5-8.9 |
Surface tension | 63.7mN/m at 860mg/L and 20℃ |
Dissociation constant | 3.03 at 20℃ |