4-Chloro-2-methylquinoline
- Product Name4-Chloro-2-methylquinoline
- CAS4295-06-1
- MFC10H8ClN
- MW177.63
- EINECS224-300-8
- MOL File4295-06-1.mol
Chemical Properties
| Melting point | 39 °C |
| Boiling point | 269-270 °C (lit.) |
| Density | 0.881 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 4.40±0.50(Predicted) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| Water Solubility | Slightly soluble in water. |
| BRN | 3522 |
| InChI | InChI=1S/C10H8ClN/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h2-6H,1H3 |
| InChIKey | HQAIROMRVBVWSK-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(Cl)=CC=1C |
| CAS DataBase Reference | 4295-06-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
