2,4-Dichloro-5-trifluoromethylpyrimidine
- Product Name2,4-Dichloro-5-trifluoromethylpyrimidine
- CAS3932-97-6
- MFC5HCl2F3N2
- MW216.98
- EINECS609-648-4
- MOL File3932-97-6.mol
Chemical Properties
| Boiling point | 49℃/32mm |
| Density | 1.609 g/mL at 25 °C |
| refractive index | 1.4749 |
| Flash point | 200 ºF |
| storage temp. | 2-8°C |
| solubility | Chloroform, Methanol |
| form | Clear Colorless to Pale Yellow Liquid |
| pka | -4.89±0.29(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C5HCl2F3N2/c6-3-2(5(8,9)10)1-11-4(7)12-3/h1H |
| InChIKey | VABVSVZAESMOCH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(C(F)(F)F)C(Cl)=N1 |
| CAS DataBase Reference | 3932-97-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,C,T |
| Risk Statements | 36/37/38-36-25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | CORROSIVE |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 29335990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 |