2-Butynyl 4-methylbenzenesulfonate
- Product Name2-Butynyl 4-methylbenzenesulfonate
- CAS56563-37-2
- MFC11H12O3S
- MW224.28
- EINECS
- MOL File56563-37-2.mol
Chemical Properties
| Melting point | 47 °C |
| Boiling point | 355.2±25.0 °C(Predicted) |
| Density | 1,012 g/cm3 |
| Flash point | >110℃ |
| storage temp. | Refrigerator (+4°C) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Orange to Green |
| Specific Gravity | 1.012 |
| Water Solubility | Insoluble |
| BRN | 3300477 |
| InChI | 1S/C11H12O3S/c1-3-4-9-14-15(12,13)11-7-5-10(2)6-8-11/h5-8H,9H2,1-2H3 |
| InChIKey | HGZKJNHJABSJTC-UHFFFAOYSA-N |
| SMILES | CC#CCOS(=O)(=O)c1ccc(C)cc1 |
| CAS DataBase Reference | 56563-37-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-37/39 |
| WGK Germany | 3 |
| HS Code | 29309099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |