| Melting point |
237-240 °C (dec.) (lit.) |
| Boiling point |
382.97°C (rough estimate) |
| Density |
1.1613 (rough estimate) |
| refractive index |
1.6180 (estimate) |
| storage temp. |
Inert atmosphere,Room Temperature |
| Water Solubility |
Insoluble in water |
| form |
powder to crystal |
| pka |
9.70±0.28(Predicted) |
| color |
White to Orange to Green |
| Merck |
14,1079 |
| BRN |
2053615 |
| InChI |
InChI=1S/C14H12N2O2/c17-15-13(11-7-3-1-4-8-11)14(16-18)12-9-5-2-6-10-12/h1-10,17-18H |
| InChIKey |
JJZONEUCDUQVGR-WXUKJITCSA-N |
| SMILES |
C(=NO)(C1=CC=CC=C1)C(=NO)C1=CC=CC=C1 |
| CAS DataBase Reference |
23873-81-6(CAS DataBase Reference) |
| EPA Substance Registry System |
Ethanedione, diphenyl-, dioxime (23873-81-6) |
