N,N-Dimethylformamide dipropyl acetal
- Product NameN,N-Dimethylformamide dipropyl acetal
- CAS6006-65-1
- MFC9H21NO2
- MW175.27
- EINECS227-855-4
- MOL File6006-65-1.mol
Chemical Properties
| Boiling point | 67-68 °C/14 mmHg (lit.) |
| Density | 0.854 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 100 °F |
| storage temp. | Flammables area |
| pka | 5.25±0.50(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| Water Solubility | It hydrolyzes with water. |
| Sensitive | Moisture Sensitive |
| BRN | 1098524 |
| InChI | InChI=1S/C9H21NO2/c1-5-7-11-9(10(3)4)12-8-6-2/h9H,5-8H2,1-4H3 |
| InChIKey | NSLGQFIDCADTAS-UHFFFAOYSA-N |
| SMILES | C(OCCC)(OCCC)N(C)C |
| CAS DataBase Reference | 6006-65-1(CAS DataBase Reference) |
| NIST Chemistry Reference | N,N-Dimethylformamide dipropyl acetal(6006-65-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29225000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
