(R)-(-)-2,2,2-TRIFLUORO-1-(9-ANTHRYL)ETHANOL
- Product Name(R)-(-)-2,2,2-TRIFLUORO-1-(9-ANTHRYL)ETHANOL
- CAS53531-34-3
- MFC16H11F3O
- MW276.26
- EINECS258-611-5
- MOL File53531-34-3.mol
Chemical Properties
| Melting point | 132-135 °C(lit.) |
| Boiling point | 423.1±45.0 °C(Predicted) |
| Density | 1.2578 (estimate) |
| refractive index | -30.5 ° (C=1, CHCl3) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 11.91±0.30(Predicted) |
| color | White to Light yellow to Green |
| optical activity | [α]25/D 30°, c = 6.0 in chloroform |
| BRN | 4695163 |
| InChI | 1S/C16H11F3O/c17-16(18,19)15(20)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9,15,20H/t15-/m1/s1 |
| InChIKey | ICZHJFWIOPYQCA-OAHLLOKOSA-N |
| SMILES | O[C@H](c1c2ccccc2cc3ccccc13)C(F)(F)F |
| CAS DataBase Reference | 53531-34-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29062990 |
| Storage Class | 11 - Combustible Solids |
