2,4,6-Trifluoroaniline
- Product Name2,4,6-Trifluoroaniline
- CAS363-81-5
- MFC6H4F3N
- MW147.1
- EINECS206-660-8
- MOL File363-81-5.mol
Chemical Properties
| Melting point | 33-37 °C (lit.) |
| Boiling point | 57 °C/22 mmHg (lit.) |
| Density | 1.3510 (estimate) |
| Flash point | 136 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| pka | 1.87±0.10(Predicted) |
| color | White or Colorless to Light yellow |
| Water Solubility | Insoluble in water. |
| BRN | 2831022 |
| InChI | InChI=1S/C6H4F3N/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
| InChIKey | BJSVKBGQDHUBHZ-UHFFFAOYSA-N |
| SMILES | C1(N)=C(F)C=C(F)C=C1F |
| CAS DataBase Reference | 363-81-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4,6-Trifluoroaniline(363-81-5) |
Safety Information
| Hazard Codes | Xi,Xn,F |
| Risk Statements | 36/37-41-38-21/22-11-37/38 |
| Safety Statements | 26-39-36/37/39-16 |
| RIDADR | UN 1325 4.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |
