7-Bromo-1H-indole-2,3-dione
- Product Name7-Bromo-1H-indole-2,3-dione
- CAS20780-74-9
- MFC8H4BrNO2
- MW226.03
- EINECS625-256-6
- MOL File20780-74-9.mol
Chemical Properties
| Melting point | 191-198 °C |
| Density | 1.826±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Slightly soluble. |
| pka | 8.69±0.20(Predicted) |
| form | powder to crystal |
| color | Orange to Amber to Dark red |
| InChI | InChI=1S/C8H4BrNO2/c9-5-3-1-2-4-6(5)10-8(12)7(4)11/h1-3H,(H,10,11,12) |
| InChIKey | OCVKSIWBTJCXPV-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2Br)C(=O)C1=O |
| CAS DataBase Reference | 20780-74-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |