2-Chloro-5-trifluoromethylbenzaldehyde
- Product Name2-Chloro-5-trifluoromethylbenzaldehyde
- CAS82386-89-8
- MFC8H4ClF3O
- MW208.57
- EINECS
- MOL File82386-89-8.mol
Chemical Properties
| Boiling point | 42-44 °C1.5 mm Hg(lit.) |
| Density | 1.435 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 193 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| color | White to Yellow to Green |
| Specific Gravity | 1.435 |
| Sensitive | Air Sensitive |
| InChI | 1S/C8H4ClF3O/c9-7-2-1-6(8(10,11)12)3-5(7)4-13/h1-4H |
| InChIKey | OZZOJJJYKYKBNH-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(Cl)c(C=O)c1 |
| CAS DataBase Reference | 82386-89-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29130000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |