Bicyclo[2.2.2]octane-1,4-dicarboxylic acid hemimethyl ester
- Product NameBicyclo[2.2.2]octane-1,4-dicarboxylic acid hemimethyl ester
- CAS18720-35-9
- MFC11H16O4
- MW212.24
- EINECS814-024-1
- MOL File18720-35-9.mol
Chemical Properties
| Melting point | 186.0 to 190.0 °C |
| Boiling point | 322.5±42.0 °C(Predicted) |
| Density | 1.307±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystaline |
| pka | 4.77±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C11H16O4/c1-15-9(14)11-5-2-10(3-6-11,4-7-11)8(12)13/h2-7H2,1H3,(H,12,13) |
| InChIKey | KBZVAQVEHVGIEI-UHFFFAOYSA-N |
| SMILES | C12(C(OC)=O)CCC(C(O)=O)(CC1)CC2 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25-36 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 2917200090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |