| Melting point |
115-117 °C |
| Boiling point |
450 °C |
| Density |
1.2086 (rough estimate) |
| refractive index |
1.5400 (estimate) |
| Flash point |
93°C |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
soluble in Acetone |
| form |
powder to crystal |
| color |
White to Almost white |
| BRN |
2059467 |
| InChI |
InChI=1S/C20H14O4/c21-19(15-8-3-1-4-9-15)23-17-12-7-13-18(14-17)24-20(22)16-10-5-2-6-11-16/h1-14H |
| InChIKey |
SUQGLJRNDJRARS-UHFFFAOYSA-N |
| SMILES |
C1(OC(=O)C2=CC=CC=C2)=CC=CC(OC(=O)C2=CC=CC=C2)=C1 |
| CAS DataBase Reference |
94-01-9(CAS DataBase Reference) |
| EPA Substance Registry System |
1,3-Benzenediol, dibenzoate (94-01-9) |
