Ethyl 5-bromovalerate
- Product NameEthyl 5-bromovalerate
- CAS14660-52-7
- MFC7H13BrO2
- MW209.08
- EINECS238-705-2
- MOL File14660-52-7.mol
Chemical Properties
| Boiling point | 104-109 °C/12 mmHg (lit.) |
| Density | 1.321 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 219 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to pale yellow |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Light Sensitive |
| BRN | 1752023 |
| InChI | InChI=1S/C7H13BrO2/c1-2-10-7(9)5-3-4-6-8/h2-6H2,1H3 |
| InChIKey | AFRWBGJRWRHQOV-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CCCCBr |
| CAS DataBase Reference | 14660-52-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Pentanoic acid, 5-bromo-, ethyl ester(14660-52-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 8-10 |
| HS Code | 29159000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
