Bis(tetrabutylammonium) sulphate
- Product NameBis(tetrabutylammonium) sulphate
- CAS2472-88-0
- MFC16H36NO4S-
- MW338.53
- EINECS219-593-4
- MOL File2472-88-0.mol
Chemical Properties
| Boiling point | 84 °C |
| Density | 1.01 g/mL at 25 °C |
| refractive index | n |
| storage temp. | 2-8°C, sealed storage, away from moisture and light |
| solubility | Fully miscible. |
| form | Liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | 1S/2C16H36N.H2O4S/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h2*5-16H2,1-4H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | ZXUCBXRTRRIBSO-UHFFFAOYSA-L |
| SMILES | [O-]S([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
