2,6-Diiodo-4-nitroaniline
- Product Name2,6-Diiodo-4-nitroaniline
- CAS5398-27-6
- MFC6H4I2N2O2
- MW389.92
- EINECS226-429-5
- MOL File5398-27-6.mol
Chemical Properties
| Melting point | 251-253 °C (lit.) |
| Boiling point | 430.8±45.0 °C(Predicted) |
| Density | 2.5050 (estimate) |
| storage temp. | 2-8°C, protect from light |
| form | powder to crystal |
| pka | -3.43±0.20(Predicted) |
| color | Light yellow to Amber to Dark green |
| λmax | 345nm(Diethyl ether)(lit.) |
| InChI | 1S/C6H4I2N2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
| InChIKey | YPVYMWQYENWFAT-UHFFFAOYSA-N |
| SMILES | Nc1c(I)cc(cc1I)[N+]([O-])=O |
| CAS DataBase Reference | 5398-27-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2921.42.9000 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |