| Melting point |
76°C |
| Boiling point |
220 °C / 7mmHg |
| Density |
1.153±0.06 g/cm3(Predicted) |
| vapor pressure |
0Pa at 25℃ |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Soluble in water |
| form |
powder to crystal |
| color |
White to Almost white |
| Water Solubility |
454.7mg/L at 25℃ |
| InChI |
InChI=1S/C16H28O6P2/c1-5-19-23(17,20-6-2)13-15-9-11-16(12-10-15)14-24(18,21-7-3)22-8-4/h9-12H,5-8,13-14H2,1-4H3 |
| InChIKey |
XTKQUBKFKSHRPS-UHFFFAOYSA-N |
| SMILES |
C1(CP(=O)(OCC)OCC)=CC=C(CP(=O)(OCC)OCC)C=C1 |
| LogP |
1.12 |
| CAS DataBase Reference |
4546-04-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Phosphonic acid, [1,4-phenylenebis(methylene)]bis-, tetraethyl ester (4546-04-7) |
