DL-2-Amino-5-phosphonopentanoic acid
- Product NameDL-2-Amino-5-phosphonopentanoic acid
- CAS76326-31-3
- MFC5H12NO5P
- MW197.13
- EINECS
- MOL File76326-31-3.mol
Chemical Properties
| Melting point | 238-245oC |
| Boiling point | 482.1±55.0 °C(Predicted) |
| Density | 1.529±0.06 g/cm3(Predicted) |
| storage temp. | Store at RT |
| solubility | NH4OH 1 M: 50 mg/mL, clear, colorless |
| pka | 2.46±0.10(Predicted) |
| form | solid |
| color | white |
| Water Solubility | Soluble to 10 mM in water and to 100 mM in 1eq. NaOH |
| BRN | 2446389 |
| InChI | InChI=1S/C5H12NO5P/c6-4(5(7)8)2-1-3-12(9,10)11/h4H,1-3,6H2,(H,7,8)(H2,9,10,11)/t4-/m0/s1 |
| InChIKey | VOROEQBFPPIACJ-BYPYZUCNSA-N |
| SMILES | C(O)(=O)[C@H](CCCP(O)(O)=O)N |
| CAS DataBase Reference | 76326-31-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
