(R)-(+)-2-Phenylglycinol
- Product Name(R)-(+)-2-Phenylglycinol
- CAS2549-14-6
- MFC8H11NO
- MW137.18
- EINECS626-292-5
- MOL File2549-14-6.mol
Chemical Properties
| Melting point | 59-65 °C(lit.) |
| Boiling point | 160°C/17mm |
| alpha | -43 º (c=2%, EtOH) |
| Density | 1.104±0.06 g/cm3(Predicted) |
| Flash point | >230 °F |
| storage temp. | 2-8°C, protect from light |
| pka | 12.04±0.35(Predicted) |
| form | powder to crystal |
| color | White to Yellow to Orange |
| optical activity | [α]22/D 39°, c = 2 in ethanol |
| Sensitive | Air Sensitive |
| BRN | 3196196 |
| InChI | InChI=1/C8H11NO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H,6,9H2/t8-/s3 |
| InChIKey | ULSIYEODSMZIPX-SBYBRXNCNA-N |
| SMILES | C1(=CC=CC=C1)[C@@H](O)CN |&1:6,r| |
| CAS DataBase Reference | 2549-14-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3259 8/PG 3 |
| WGK Germany | 3 |
| F | 3-10-23-34 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29062990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
![(2RS,3SR)-1-[3-(2-chlorophenyl)-2,3-epoxy-2-(4-fluorophenyl)propyl]-1H-1,2,4-triazole pictures](https://img.chemicalbook.com/ProductImageEN/2020-1/Small/a6d06eaa-fc98-4d3e-91f0-d9c216d233fd.jpg)