| Melting point |
~110 °C (dec.) |
| alpha |
-15 º (c=1, CH30H) |
| Boiling point |
390.28°C (rough estimate) |
| Density |
1.2868 (rough estimate) |
| refractive index |
-15 ° (C=1, MeOH) |
| storage temp. |
2-8°C |
| Water Solubility |
Soluble in water |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form |
powder to crystal |
| pka |
3.83±0.10(Predicted) |
| color |
White to Almost white |
| optical activity |
[α]20/D 14.5±2°, c = 1% in methanol |
| BRN |
2418563 |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C10H17NO6/c1-10(2,3)17-9(16)11-6(8(14)15)4-5-7(12)13/h6H,4-5H2,1-3H3,(H,11,16)(H,12,13)(H,14,15)/t6-/m0/s1 |
| InChIKey |
AQTUACKQXJNHFQ-LURJTMIESA-N |
| SMILES |
C(O)(=O)[C@H](CCC(O)=O)NC(OC(C)(C)C)=O |
| CAS DataBase Reference |
2419-94-5(CAS DataBase Reference) |