Tetrachlorophthalimide
- Product NameTetrachlorophthalimide
- CAS1571-13-7
- MFC8HCl4NO2
- MW284.91
- EINECS216-386-0
- MOL File1571-13-7.mol
Chemical Properties
| Melting point | >300 °C(lit.) |
| Density | 1.9286 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMF: soluble25mg/mL, clear, light yellow |
| pka | 5.78±0.20(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | 1S/C8HCl4NO2/c9-3-1-2(8(15)13-7(1)14)4(10)6(12)5(3)11/h(H,13,14,15) |
| InChIKey | LPUUYZVKCMCHLO-UHFFFAOYSA-N |
| SMILES | Clc1c(Cl)c(Cl)c2C(=O)NC(=O)c2c1Cl |
| CAS DataBase Reference | 1571-13-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Isoindole-1,3(2H)-dione, 4,5,6,7-tetrachloro- (1571-13-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29251900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |