BOC-NVA-OH
- Product NameBOC-NVA-OH
- CAS53308-95-5
- MFC10H19NO4
- MW217.26
- EINECS1533716-785-6
- MOL File53308-95-5.mol
Chemical Properties
| Melting point | 43-47 °C |
| Boiling point | 357.82°C (rough estimate) |
| Density | 1.1518 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 4.02±0.20(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 3607582 |
| Major Application | peptide synthesis |
| InChI | 1S/C10H19NO4/c1-5-6-7(8(12)13)11-9(14)15-10(2,3)4/h7H,5-6H2,1-4H3,(H,11,14)(H,12,13)/t7-/m0/s1 |
| InChIKey | INWOAUUPYIXDHN-ZETCQYMHSA-N |
| SMILES | CCC[C@H](NC(=O)OC(C)(C)C)C(O)=O |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29241990 |
| Storage Class | 10 - Combustible liquids |
