| Melting point |
122 °C |
| Boiling point |
417.0±33.0 °C(Predicted) |
| Density |
1.046±0.06 g/cm3(Predicted) |
| solubility |
soluble in Methanol |
| form |
powder to crystal |
| pka |
12.04±0.40(Predicted) |
| color |
White to Almost white |
| Water Solubility |
14mg/L at 20℃ |
| InChI |
InChI=1S/C19H33O4P/c1-9-22-24(21,23-10-2)13-14-11-15(18(3,4)5)17(20)16(12-14)19(6,7)8/h11-12,20H,9-10,13H2,1-8H3 |
| InChIKey |
GJDRKHHGPHLVNI-UHFFFAOYSA-N |
| SMILES |
P(CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1)(=O)(OCC)OCC |
| LogP |
2.9 at 23℃ |
| CAS DataBase Reference |
976-56-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Phosphonic acid, [[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]-, diethyl ester (976-56-7) |
