4-Bromo-2-fluorotoluene
- Product Name4-Bromo-2-fluorotoluene
- CAS51436-99-8
- MFC7H6BrF
- MW189.02
- EINECS257-201-3
- MOL File51436-99-8.mol
Chemical Properties
| Boiling point | 68 °C (8 mmHg) |
| Density | 1.492 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 169 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | water: insoluble |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.492 |
| Water Solubility | INSOLUBLE |
| BRN | 1859028 |
| InChI | InChI=1S/C7H6BrF/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
| InChIKey | YZFVUQSAJMLFOZ-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 51436-99-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-52/53 |
| Safety Statements | 26-61-37/39 |
| RIDADR | UN 2810 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
