Diphosphoryl chloride
- Product NameDiphosphoryl chloride
- CAS13498-14-1
- MFCl4O3P2
- MW251.76
- EINECS236-824-4
- MOL File13498-14-1.mol
Chemical Properties
| Melting point | <-50°C |
| Boiling point | 90 °C12 mm Hg(lit.) |
| Density | 1.82 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 101°C/10mm |
| storage temp. | −20°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Colorless to pale yellow |
| Specific Gravity | 1.82 |
| Water Solubility | Reacts violently with waterMiscible with most organic solvents. |
| Sensitive | Air & Moisture Sensitive |
| InChI | InChI=1S/Cl4O3P2/c1-8(2,5)7-9(3,4)6 |
| InChIKey | CNTIXUGILVWVHR-UHFFFAOYSA-N |
| SMILES | P(Cl)(Cl)(OP(Cl)(Cl)=O)=O |
| CAS DataBase Reference | 13498-14-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 26-36/37/39-45-60-30-23-20-8 |
| RIDADR | UN 3264 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 28121049 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |