2-Fluoro-5-aminotoluene
- Product Name2-Fluoro-5-aminotoluene
- CAS452-69-7
- MFC7H8FN
- MW125.14
- EINECS207-207-7
- MOL File452-69-7.mol
Chemical Properties
| Melting point | 35 °C |
| Boiling point | 85-86°C 9mm |
| Density | 1,12 g/cm3 |
| refractive index | 1.5370 |
| Flash point | 95°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.78±0.10(Predicted) |
| color | White to Gray |
| BRN | 2935561 |
| InChI | InChI=1S/C7H8FN/c1-5-4-6(9)2-3-7(5)8/h2-4H,9H2,1H3 |
| InChIKey | NYMDPDNETOLVBS-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(F)C(C)=C1 |
| CAS DataBase Reference | 452-69-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Fluoro-3-methylaniline(452-69-7) |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-36-27 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
