| Boiling point |
100-101 °C6 mm Hg(lit.) |
| Density |
0.966 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.417(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Storage temp. 2-8°C |
| form |
liquid |
| Specific Gravity |
0.961 |
| Appearance |
Colorless to light yellow Liquid |
| Water Solubility |
Not miscible in water. |
| Sensitive |
Moisture Sensitive |
| Hydrolytic Sensitivity |
7: reacts slowly with moisture/water |
| BRN |
1942237 |
| InChI |
InChI=1S/C10H21NO3Si/c1-4-12-15(13-5-2,14-6-3)10-8-7-9-11/h4-8,10H2,1-3H3 |
| InChIKey |
VGIURMCNTDVGJM-UHFFFAOYSA-N |
| SMILES |
C(#N)CCC[Si](OCC)(OCC)OCC |
| CAS DataBase Reference |
1067-47-6(CAS DataBase Reference) |
| EPA Substance Registry System |
Butanenitrile, 4-(triethoxysilyl)- (1067-47-6) |
