3-Amino-5-bromo-2-chloropyridine
- Product Name3-Amino-5-bromo-2-chloropyridine
- CAS588729-99-1
- MFC5H4BrClN2
- MW207.46
- EINECS675-552-4
- MOL File588729-99-1.mol
Chemical Properties
| Melting point | 129-132℃ |
| Boiling point | 296.8±35.0 °C(Predicted) |
| Density | 1.834±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 0.03±0.10(Predicted) |
| color | White to Orange to Green |
| λmax | 314nm(EtOH)(lit.) |
| InChI | InChI=1S/C5H4BrClN2/c6-3-1-4(8)5(7)9-2-3/h1-2H,8H2 |
| InChIKey | ZSEZSALOLWCCGT-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(Br)C=C1N |
| CAS DataBase Reference | 588729-99-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 25-37/38-41-22 |
| Safety Statements | 26-39-45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
