| Melting point |
314-318 °C(lit.) |
| Boiling point |
386.91℃[at 101 325 Pa] |
| Density |
1.467±0.06 g/cm3(Predicted) |
| vapor pressure |
0Pa at 25℃ |
| form |
powder to crystal |
| pka |
-1.24±0.42(Predicted) |
| color |
White to Gray to Red |
| Water Solubility |
21.55g/L at 25℃ |
| InChI |
InChI=1S/C7H9NO4S/c1-12-6-3-2-5(8)4-7(6)13(9,10)11/h2-4H,8H2,1H3,(H,9,10,11) |
| InChIKey |
JXZGTFLJFKLVAX-UHFFFAOYSA-N |
| SMILES |
C1(S(O)(=O)=O)=CC(N)=CC=C1OC |
| LogP |
-2 at 25℃ |
| CAS DataBase Reference |
6470-17-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzenesulfonic acid, 5-amino-2-methoxy- (6470-17-3) |
