ALPHA-AMANITIN
- Product NameALPHA-AMANITIN
- CAS23109-05-9
- MFC39H54N10O14S
- MW918.98
- EINECS245-432-2
- MOL File23109-05-9.mol
Chemical Properties
| Melting point | 254-255 °C(lit.) |
| alpha | D20 +191° |
| Boiling point | 1622.2±65.0 °C(Predicted) |
| Density | 1.1626 (rough estimate) |
| refractive index | 1.7400 (estimate) |
| storage temp. | −20°C |
| solubility | H2O: 1.0 mg/mL |
| form | powder |
| pka | 9.63±0.70(Predicted) |
| color | white to light yellow |
| biological source | Amanita phalloides |
| optical activity | +19120 (H2O) |
| Water Solubility | Soluble to 5 mM in ethanol and to 5 mM in water |
| ε(extinction coefficient) | 13,500 at 310nm in H2O at 1M |
| Merck | 13,370 |
| BRN | 1071138 |
| InChIKey | CIORWBWIBBPXCG-PWKRRBCNNA-N |
| SMILES | CCC(C)C1NC(=O)CNC(=O)C2Cc3c([nH]c4cc(O)ccc34)S(=O)CC(NC(=O)CNC1=O)C(=O)NC(CC(N)=O)C(=O)N5CC(O)CC5C(=O)NC(C(C)C(O)CO)C(=O)N2 |
Safety Information
| Hazard Codes | T+ |
| Risk Statements | 26/27/28-33-26/28 |
| Safety Statements | 36/37/39-45-36/37-28 |
| RIDADR | UN 3462 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | BD6195000 |
| F | 8-10-18-21 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 2934999090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Oral STOT RE 2 |
| Hazardous Substances Data | 23109-05-9(Hazardous Substances Data) |
| Toxicity | LD50 i.p. in albino mice: 0.1 mg/kg (Wieland, Wieland) |
