1,3-Bis(N-carbazolyl)benzene
- Product Name1,3-Bis(N-carbazolyl)benzene
- CAS550378-78-4
- MFC30H20N2
- MW408.49
- EINECS
- MOL File550378-78-4.mol
Chemical Properties
| Melting point | 176-178°C |
| Boiling point | 644.2±51.0 °C(Predicted) |
| Density | 1.21 |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| λmax | 292338 nm |
| InChI | InChI=1S/C30H20N2/c1-5-16-27-23(12-1)24-13-2-6-17-28(24)31(27)21-10-9-11-22(20-21)32-29-18-7-3-14-25(29)26-15-4-8-19-30(26)32/h1-20H |
| InChIKey | MZYDBGLUVPLRKR-UHFFFAOYSA-N |
| SMILES | C1(N2C3=C(C=CC=C3)C3=C2C=CC=C3)=CC=CC(N2C3=C(C=CC=C3)C3=C2C=CC=C3)=C1 |
| Absorption | λmax 292, 338 nm (in THF) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-36/37/39-41-37/38 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |