Carbamic acid, (3-oxocyclobutyl)-, 1,1-dimethylethyl ester (9CI)
- Product NameCarbamic acid, (3-oxocyclobutyl)-, 1,1-dimethylethyl ester (9CI)
- CAS154748-49-9
- MFC9H15NO3
- MW185.22
- EINECS817-050-1
- MOL File154748-49-9.mol
Chemical Properties
| Melting point | 120-125℃ |
| Boiling point | 302.1±31.0 °C(Predicted) |
| Density | 1.10±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 11.60±0.20(Predicted) |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C9H15NO3/c1-9(2,3)13-8(12)10-6-4-7(11)5-6/h6H,4-5H2,1-3H3,(H,10,12) |
| InChIKey | FNHPTFKSPUTESA-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NC1CC(=O)C1 |
Safety Information
| Risk Statements | 52-51/53-36/37/38 |
| Safety Statements | 3/9-4-22-26-28-29-35-44 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
