2-Bromobutyric acid methyl ester
- Product Name2-Bromobutyric acid methyl ester
- CAS3196-15-4
- MFC5H9BrO2
- MW181.03
- EINECS221-699-0
- MOL File3196-15-4.mol
Chemical Properties
| Melting point | 116 °C |
| Boiling point | 172 °C |
| Density | 1.41 |
| refractive index | 1.45 |
| Flash point | 68 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.573 |
| Water Solubility | Soluble in alcohol and ether, slightly soluble in water. |
| BRN | 1720826 |
| InChI | InChI=1S/C5H9BrO2/c1-3-4(6)5(7)8-2/h4H,3H2,1-2H3 |
| InChIKey | UFQQDNMQADCHGH-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(Br)CC |
| CAS DataBase Reference | 3196-15-4(CAS DataBase Reference) |
| EPA Substance Registry System | Methyl 2-bromobutyrate (3196-15-4) |
Safety Information
| Hazard Codes | C,Xi,F |
| Risk Statements | 34-38-11 |
| Safety Statements | 26-36/37/39-45-24-16-9 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| F | 19 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
