BETA-ELEMENE
- Product NameBETA-ELEMENE
- CAS515-13-9
- MFC15H24
- MW204.35
- EINECS679-283-3
- MOL File515-13-9.mol
Chemical Properties
| Boiling point | 252℃ |
| Density | 0.862 |
| Flash point | 98℃ |
| storage temp. | 2-8°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; Ethanol:PBS (pH 7.2) (1:2): 0.3 mg/ml |
| form | Liquid |
| color | Colorless to light yellow |
| Odor | at 100.00?%. sweet |
| BRN | 2207781 |
| Stability | Volatile |
| Major Application | food and beverages |
| InChI | InChI=1S/C15H24/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h7,13-14H,1-2,4,8-10H2,3,5-6H3/t13-,14+,15-/m1/s1 |
| InChIKey | OPFTUNCRGUEPRZ-RBSFLKMASA-N |
| SMILES | [C@@]1(C=C)(C)CC[C@@H](C(C)=C)C[C@H]1C(C)=C |
| LogP | 5.772 (est) |
Safety Information
| Risk Statements | 66 |
| WGK Germany | 3 |
| RTECS | GU9660000 |
| Storage Class | 10 - Combustible liquids |
