4-Amino-2,6-dichlorophenol
- Product Name4-Amino-2,6-dichlorophenol
- CAS5930-28-9
- MFC6H5Cl2NO
- MW178.02
- EINECS227-671-4
- MOL File5930-28-9.mol
Chemical Properties
| Melting point | 167-170 °C (lit.) |
| Boiling point | 303.6±42.0 °C(Predicted) |
| Density | 1.2549 (rough estimate) |
| refractive index | 1.5680 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 7.29±0.23(Predicted) |
| color | Beige or slightly brown to pale reddish |
| BRN | 2361665 |
| Stability | Stable. Incompatible with acids, acid chlorides, acid anhydrides, chloroformates, strong oxidizing agents. |
| InChI | InChI=1S/C6H5Cl2NO/c7-4-1-3(9)2-5(8)6(4)10/h1-2,10H,9H2 |
| InChIKey | KGEXISHTCZHGFT-UHFFFAOYSA-N |
| SMILES | C1(O)=C(Cl)C=C(N)C=C1Cl |
| CAS DataBase Reference | 5930-28-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 4-amino-2,6-dichloro-(5930-28-9) |
| EPA Substance Registry System | Phenol, 4-amino-2,6-dichloro- (5930-28-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | SJ5774500 |
| TSCA | TSCA listed |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |
