| Melting point |
167-170 °C (lit.) |
| Boiling point |
303.6±42.0 °C(Predicted) |
| Density |
1.2549 (rough estimate) |
| refractive index |
1.5680 (estimate) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
soluble in Methanol |
| form |
Powder |
| pka |
7.29±0.23(Predicted) |
| color |
Beige or slightly brown to pale reddish |
| BRN |
2361665 |
| Stability |
Stable. Incompatible with acids, acid chlorides, acid anhydrides, chloroformates, strong oxidizing agents. |
| InChI |
InChI=1S/C6H5Cl2NO/c7-4-1-3(9)2-5(8)6(4)10/h1-2,10H,9H2 |
| InChIKey |
KGEXISHTCZHGFT-UHFFFAOYSA-N |
| SMILES |
C1(O)=C(Cl)C=C(N)C=C1Cl |
| CAS DataBase Reference |
5930-28-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
Phenol, 4-amino-2,6-dichloro-(5930-28-9) |
| EPA Substance Registry System |
Phenol, 4-amino-2,6-dichloro- (5930-28-9) |
