Ethyl 3-furancarboxylate
- Product NameEthyl 3-furancarboxylate
- CAS614-98-2
- MFC7H8O3
- MW140.14
- EINECS210-403-5
- MOL File614-98-2.mol
Chemical Properties
| Boiling point | 93-95 °C35 mm Hg(lit.) |
| Density | 1.038 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 139 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C7H8O3/c1-2-10-7(8)6-3-4-9-5-6/h3-5H,2H2,1H3 |
| InChIKey | LOFDXZJSDVCYAS-UHFFFAOYSA-N |
| SMILES | O1C=CC(C(OCC)=O)=C1 |
| LogP | 1.780 |
| CAS DataBase Reference | 614-98-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,H226 |
| Safety Statements | 24/25 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29321900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
