2 6-Dichloropyridine-3-carboxaldehyde
- Product Name2 6-Dichloropyridine-3-carboxaldehyde
- CAS55304-73-9
- MFC6H3Cl2NO
- MW176
- EINECS
- MOL File55304-73-9.mol
Chemical Properties
| Melting point | 74-75 °C (lit.) |
| Boiling point | 95°C/3mmHg(lit.) |
| Density | 1.488±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | -4.52±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C6H3Cl2NO/c7-5-2-1-4(3-10)6(8)9-5/h1-3H |
| InChIKey | HWTMRGXKSANEDO-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC=C1C=O |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-43 |
| Safety Statements | 26-36/37 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |