| Boiling point |
102 °C / 1mmHg |
| Density |
0,83 g/cm3 |
| vapor pressure |
2hPa at 10℃ |
| refractive index |
1.4450 to 1.4480 |
| Flash point |
92°C |
| storage temp. |
2-8°C, protect from light |
| form |
clear liquid |
| pka |
9.88±0.28(Predicted) |
| color |
Colorless to Yellow to Green |
| Odor |
Fishy odor |
| Water Solubility |
193.9g/L at 25℃ |
| InChI |
InChI=1S/C11H27N3/c1-12(2)8-6-10-14(5)11-7-9-13(3)4/h6-11H2,1-5H3 |
| InChIKey |
SKCNNQDRNPQEFU-UHFFFAOYSA-N |
| SMILES |
C(N(CCCN(C)C)C)CCN(C)C |
| LogP |
0 at 25℃ |
| CAS DataBase Reference |
3855-32-1(CAS DataBase Reference) |
| EPA Substance Registry System |
1,3-Propanediamine, N-[3-(dimethylamino)propyl]-N,N',N'-trimethyl- (3855-32-1) |
