Dichloramine T
- Product NameDichloramine T
- CAS473-34-7
- MFC7H7Cl2NO2S
- MW240.11
- EINECS207-462-4
- MOL File473-34-7.mol
Chemical Properties
| Melting point | 79°C |
| Boiling point | 330℃ |
| Density | 1.491 |
| refractive index | 1.6000 (estimate) |
| Flash point | 153℃ |
| storage temp. | -20°C |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | -27.61±0.70(Predicted) |
| color | White to Light yellow |
| Merck | 14,3047 |
| InChI | 1S/C7H7Cl2NO2S/c1-6-2-4-7(5-3-6)13(11,12)10(8)9/h2-5H,1H3 |
| InChIKey | ARGDYOIRHYLIMT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)S(=O)(=O)N(Cl)Cl |
| EPA Substance Registry System | Benzenesulfonamide, N,N-dichloro-4-methyl- (473-34-7) |
Safety Information
| Hazard Codes | O,Xi |
| Risk Statements | 8-36/37/38 |
| Safety Statements | 17-26-36/37/39 |
| RIDADR | 1479 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 5.1 |
| PackingGroup | I |
| HS Code | 29350090 |
| Storage Class | 5.1A - Strongly oxidizing hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Ox. Sol. 1 Skin Irrit. 2 STOT SE 3 |