(2S)-Bornane-10,2-sultam
- Product Name(2S)-Bornane-10,2-sultam
- CAS108448-77-7
- MFC10H17NO2S
- MW215.31
- EINECS
- MOL File108448-77-7.mol
Chemical Properties
| Melting point | 185-187 °C(lit.) |
| alpha | 33 º (c=4.9, CHCl3) |
| Boiling point | 324.8±25.0 °C(Predicted) |
| Density | 1.1469 (rough estimate) |
| refractive index | 31 ° (C=1, CHCl3) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Chloroform |
| form | powder to crystal |
| pka | 11.05±0.40(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D +32°, c = 5 in chloroform |
| BRN | 4675755 |
| InChI | InChI=1S/C10H17NO2S/c1-9(2)7-3-4-10(9)6-14(12,13)11-8(10)5-7/h7-8,11H,3-6H2,1-2H3/t7-,8-,10-/m0/s1 |
| InChIKey | DPJYJNYYDJOJNO-CFGJQEBVSA-N |
| SMILES | N1[C@]2([H])[C@@]3(C(C)(C)[C@]([H])(C2)CC3)CS1(=O)=O |
| CAS DataBase Reference | 108448-77-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |