Ethyl mandelate
- Product NameEthyl mandelate
- CAS774-40-3
- MFC10H12O3
- MW180.2
- EINECS212-263-0
- MOL File774-40-3.mol
Chemical Properties
| Melting point | 37 °C |
| Boiling point | 253-255 °C(lit.) |
| Density | 1.115 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| pka | 12.33±0.20(Predicted) |
| color | White or Colorless to Light yellow |
| FreezingPoint | 23.0 to 27.0 ℃ |
| InChI | InChI=1S/C10H12O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3 |
| InChIKey | SAXHIDRUJXPDOD-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(C1=CC=CC=C1)O |
| CAS DataBase Reference | 774-40-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 37/39-26 |
| WGK Germany | 2 |
| RTECS | OO7397000 |
| HS Code | 2918 19 98 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 |