LUMICHROME
- Product NameLUMICHROME
- CAS1086-80-2
- MFC12H10N4O2
- MW242.23
- EINECS214-120-8
- MOL File1086-80-2.mol
Chemical Properties
| Melting point | 300 °C |
| Boiling point | 385.06°C (rough estimate) |
| Density | 1.2532 (rough estimate) |
| refractive index | 1.6081 (estimate) |
| storage temp. | Refrigerator |
| solubility | Aqueous Base (Slightly), DMSO (Slightly, Heated, Sonicated) |
| pka | 10.02±0.70(Predicted) |
| form | Solid |
| color | Pale Yellow to Yellow |
| λmax | 350 nm 392 nm (2nd) |
| Merck | 13,5620 |
| Stability | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C12H10N4O2/c1-5-3-7-8(4-6(5)2)14-10-9(13-7)11(17)16-12(18)15-10/h3-4H,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | ZJTJUVIJVLLGSP-UHFFFAOYSA-N |
| SMILES | Cc1cc2nc3NC(=O)NC(=O)c3nc2cc1C |
| CAS DataBase Reference | 1086-80-2(CAS DataBase Reference) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 2933.99.8210 |
| Storage Class | 11 - Combustible Solids |
