1-(1,1-Dimethylethyl) (2S,4R)-4-fluoro-1,2-pyrrolidinedicarboxylate
- Product Name1-(1,1-Dimethylethyl) (2S,4R)-4-fluoro-1,2-pyrrolidinedicarboxylate
- CAS203866-14-2
- MFC10H16FNO4
- MW233.24
- EINECS
- MOL File203866-14-2.mol
Chemical Properties
| Melting point | 115-119°C |
| Boiling point | 346.0±42.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| refractive index | -69 ° (C=1, MeOH) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.53±0.40(Predicted) |
| color | White to Almost white |
| optical activity | [α]22/D -65.0±5°, c = 1 in chloroform |
| InChI | InChI=1S/C10H16FNO4/c1-10(2,3)16-9(15)12-5-6(11)4-7(12)8(13)14/h6-7H,4-5H2,1-3H3,(H,13,14)/t6-,7+/m1/s1 |
| InChIKey | YGWZXQOYEBWUTH-RQJHMYQMSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C[C@H](F)C[C@H]1C(O)=O |
| CAS DataBase Reference | 203866-14-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
