5-Bromovaleryl chloride
- Product Name5-Bromovaleryl chloride
- CAS4509-90-4
- MFC5H8BrClO
- MW199.47
- EINECS629-364-4
- MOL File4509-90-4.mol
Chemical Properties
| Boiling point | 116-118 °C/33 mmHg (lit.) |
| Density | 1.49 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 225 °F |
| storage temp. | -20°C, sealed storage, away from moisture |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.49 |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive/Lachrymatory |
| InChI | InChI=1S/C5H8BrClO/c6-4-2-1-3-5(7)8/h1-4H2 |
| InChIKey | OKRUMSWHDWKGHA-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)CCCCBr |
| CAS DataBase Reference | 4509-90-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Corrosive/Lachrymatory/Moisture Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29159000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Skin Corr. 1B STOT SE 3 |
