4-Chlorophenyl isothiocyanate
- Product Name4-Chlorophenyl isothiocyanate
- CAS2131-55-7
- MFC7H4ClNS
- MW169.63
- EINECS218-358-3
- MOL File2131-55-7.mol
Chemical Properties
| Melting point | 42-44 °C(lit.) |
| Boiling point | 135-136 °C24 mm Hg(lit.) |
| Density | 1.3181 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| Flash point | 110 °C |
| storage temp. | Refrigerator (+4°C) |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 471610 |
| InChI | InChI=1S/C7H4ClNS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| InChIKey | MZZVFXMTZTVUFO-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(N=C=S)C=C1 |
| CAS DataBase Reference | 2131-55-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 23/24-36/37/38-42-42/43-23/24/25 |
| Safety Statements | 22-26-36/37/39-45-36/37 |
| RIDADR | UN 2206 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | NX8473000 |
| F | 10-21-19 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |